Acebutolol
{{Drugbox | verifiedrevid = 477237780 | IUPAC_name = (''RS'')-''N''-| tradename = Sectral, Prent, others | Drugs.com = | MedlinePlus = a687003 | licence_US = Acebutolol | pregnancy_AU = C | pregnancy_US = B | pregnancy_category = | legal_UK = POM | legal_status = Rx-only | routes_of_administration = By mouth, IV
| bioavailability = 40% (range 35 to 50%) | metabolism = Hepatic | elimination_half-life = 3-4 hours (parent drug)
8-13 hours (active metabolite) | excretion = Renal: 30%
Biliary: 60%
| IUPHAR_ligand = 7107 | CAS_number_Ref = | CAS_number = 37517-30-9 | ATC_prefix = C07 | ATC_suffix = AB04 | PubChem = 1978 | DrugBank_Ref = | DrugBank = DB01193 | ChemSpiderID_Ref = | ChemSpiderID = 1901 | UNII_Ref = | UNII = 67P356D8GH | KEGG_Ref = | KEGG = D02338 | ChEBI_Ref = | ChEBI = 2379 | ChEMBL_Ref = | ChEMBL = 642
| C=18 | H=28 | N=2 | O=4 | smiles = O=C(Nc1ccc(OCC(O)CNC(C)C)c(c1)C(=O)C)CCC | StdInChI_Ref = | StdInChI = 1S/C18H28N2O4/c1-5-6-18(23)20-14-7-8-17(16(9-14)13(4)21)24-11-15(22)10-19-12(2)3/h7-9,12,15,19,22H,5-6,10-11H2,1-4H3,(H,20,23) | StdInChIKey_Ref = | StdInChIKey = GOEMGAFJFRBGGG-UHFFFAOYSA-N | melting_point = 121 }}
Acebutolol, sold under the brand names Sectral among others, is a beta blocker for the treatment of hypertension and arrhythmias. Acebutolol is a cardioselective beta-1 blocker and has intrinsic sympathetic activity. It is commonly used in the treatment of angina.
It was patented in 1967 and approved for medical use in 1973. Provided by Wikipedia
-
1
-
2